C20H25FN4O3 — CID 122698104
N-[2-[6-fluoro-2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]propanamide (PubChem CID 122698104) has the molecular formula C20H25FN4O3 and a molecular weight of 388.44 g/mol. Its IUPAC name is N-[2-[6-fluoro-2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]propanamide.
| Compound Name | N-[2-[6-fluoro-2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]propanamide |
|---|---|
| PubChem CID | 122698104 |
| Molecular Formula | C20H25FN4O3 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[2-[6-fluoro-2-methyl-5-[2-(1-methylpyrazol-3-yl)oxyethoxy]-1H-indol-3-yl]ethyl]propanamide |
| SMILES | CCC(=O)NCCc1c(C)[nH]c2cc(F)c(OCCOc3ccn(C)n3)cc12 |
| InChI | InChI=1S/C20H25FN4O3/c1-4-19(26)22-7-5-14-13(2)23-17-12-16(21)18(11-15(14)17)27-9-10-28-20-6-8-25(3)24-20/h6,8,11-12,23H,4-5,7,9-10H2,1-3H3,(H,22,26) |
| InChIKey | DTUPXNIFMHQCCX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|