C19H20N2OS — CID 122698181
2-(2,2-dimethylpropylsulfanyl)-3-phenylquinazolin-4-one (PubChem CID 122698181) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 2-(2,2-dimethylpropylsulfanyl)-3-phenylquinazolin-4-one.
| Compound Name | 2-(2,2-dimethylpropylsulfanyl)-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 122698181 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(2,2-dimethylpropylsulfanyl)-3-phenylquinazolin-4-one |
| SMILES | CC(C)(C)CSc1nc2ccccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C19H20N2OS/c1-19(2,3)13-23-18-20-16-12-8-7-11-15(16)17(22)21(18)14-9-5-4-6-10-14/h4-12H,13H2,1-3H3 |
| InChIKey | GMUIDKJUSNEWSL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |