C31H34ClF3N2O5 — CID 122700544
3-[(3R,4S)-1-[(3R,6S)-6-[8-chloro-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-3-methylpiperidin-4-yl]benzoic acid (PubChem CID 122700544) has the molecular formula C31H34ClF3N2O5 and a molecular weight of 607.07 g/mol. Its IUPAC name is 3-[(3R,4S)-1-[(3R,6S)-6-[8-chloro-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-3-methylpiperidin-4-yl]benzoic acid.
| Compound Name | 3-[(3R,4S)-1-[(3R,6S)-6-[8-chloro-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-3-methylpiperidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 122700544 |
| Molecular Formula | C31H34ClF3N2O5 |
| Molecular Weight | 607.07 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 3-[(3R,4S)-1-[(3R,6S)-6-[8-chloro-6-(trifluoromethyl)-2,4-dihydro-1,3-benzoxazine-3-carbonyl]-6-cyclopropyloxan-3-yl]-3-methylpiperidin-4-yl]benzoic acid |
| SMILES | C[C@H]1CN([C@@H]2CC[C@@](C(=O)N3COc4c(Cl)cc(C(F)(F)F)cc4C3)(C3CC3)OC2)CC[C@@H]1c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C31H34ClF3N2O5/c1-18-14-36(10-8-25(18)19-3-2-4-20(11-19)28(38)39)24-7-9-30(42-16-24,22-5-6-22)29(40)37-15-21-12-23(31(33,34)35)13-26(32)27(21)41-17-37/h2-4,11-13,18,22,24-25H,5-10,14-17H2,1H3,(H,38,39)/t18-,24+,25-,30-/m0/s1 |
| InChIKey | GOTMAHBHCPXLEE-IFYCLVCUSA-N |
| XLogP | 6.19 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.07 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |