C15H21NS — CID 122701143
1-isothiocyanato-2,4-bis(2-methylpropyl)benzene (PubChem CID 122701143) has the molecular formula C15H21NS and a molecular weight of 247.41 g/mol. Its IUPAC name is 1-isothiocyanato-2,4-bis(2-methylpropyl)benzene.
| Compound Name | 1-isothiocyanato-2,4-bis(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 122701143 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 1-isothiocyanato-2,4-bis(2-methylpropyl)benzene |
| SMILES | CC(C)Cc1ccc(N=C=S)c(CC(C)C)c1 |
| InChI | InChI=1S/C15H21NS/c1-11(2)7-13-5-6-15(16-10-17)14(9-13)8-12(3)4/h5-6,9,11-12H,7-8H2,1-4H3 |
| InChIKey | XAOYXJDITNTGHE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|