C25H25F2N5O6S — CID 122701179
(1R,2S)-1-(2,4-difluorophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-1-hydroxypropane-2-sulfonamide (PubChem CID 122701179) has the molecular formula C25H25F2N5O6S and a molecular weight of 561.57 g/mol. Its IUPAC name is (1R,2S)-1-(2,4-difluorophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-1-hydroxypropane-2-sulfonamide.
| Compound Name | (1R,2S)-1-(2,4-difluorophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-1-hydroxypropane-2-sulfonamide |
|---|---|
| PubChem CID | 122701179 |
| Molecular Formula | C25H25F2N5O6S |
| Molecular Weight | 561.57 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | (1R,2S)-1-(2,4-difluorophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-1-hydroxypropane-2-sulfonamide |
| SMILES | COc1cccc(-c2nnc(NS(=O)(=O)[C@@H](C)[C@H](O)c3ccc(F)cc3F)n2-c2c(OC)cccc2OC)n1 |
| InChI | InChI=1S/C25H25F2N5O6S/c1-14(23(33)16-12-11-15(26)13-17(16)27)39(34,35)31-25-30-29-24(18-7-5-10-21(28-18)38-4)32(25)22-19(36-2)8-6-9-20(22)37-3/h5-14,23,33H,1-4H3,(H,30,31)/t14-,23-/m0/s1 |
| InChIKey | DPXBHJKGQHAODS-PSLXWICFSA-N |
| XLogP | 3.50 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |