C23H35N5O6S — CID 145191613
(2R,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-3-hydroxy-4,4-dimethylpentane-2-sulfonamide;molecular hydrogen (PubChem CID 145191613) has the molecular formula C23H35N5O6S and a molecular weight of 509.63 g/mol. Its IUPAC name is (2R,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-3-hydroxy-4,4-dimethylpentane-2-sulfonamide;molecular hydrogen.
| Compound Name | (2R,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-3-hydroxy-4,4-dimethylpentane-2-sulfonamide;molecular hydrogen |
|---|---|
| PubChem CID | 145191613 |
| Molecular Formula | C23H35N5O6S |
| Molecular Weight | 509.63 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | (2R,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-3-hydroxy-4,4-dimethylpentane-2-sulfonamide;molecular hydrogen |
| SMILES | COc1cccc(-c2nnc(NS(=O)(=O)[C@H](C)[C@H](O)C(C)(C)C)n2-c2c(OC)cccc2OC)n1.[H][H].[H][H] |
| InChI | InChI=1S/C23H31N5O6S.2H2/c1-14(20(29)23(2,3)4)35(30,31)27-22-26-25-21(15-10-8-13-18(24-15)34-7)28(22)19-16(32-5)11-9-12-17(19)33-6;;/h8-14,20,29H,1-7H3,(H,26,27);2*1H/t14-,20+;;/m1../s1 |
| InChIKey | HOKPLRZYHHDCQI-OXMVISPPSA-N |
| XLogP | 3.38 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |