C25H27N5O2 — CID 122703075
1-[2-(1-ethylindol-2-yl)-1-methylbenzimidazole-5-carbonyl]piperidine-4-carboxamide (PubChem CID 122703075) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-[2-(1-ethylindol-2-yl)-1-methylbenzimidazole-5-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(1-ethylindol-2-yl)-1-methylbenzimidazole-5-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 122703075 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 1-[2-(1-ethylindol-2-yl)-1-methylbenzimidazole-5-carbonyl]piperidine-4-carboxamide |
| SMILES | CCn1c(-c2nc3cc(C(=O)N4CCC(C(N)=O)CC4)ccc3n2C)cc2ccccc21 |
| InChI | InChI=1S/C25H27N5O2/c1-3-30-20-7-5-4-6-17(20)15-22(30)24-27-19-14-18(8-9-21(19)28(24)2)25(32)29-12-10-16(11-13-29)23(26)31/h4-9,14-16H,3,10-13H2,1-2H3,(H2,26,31) |
| InChIKey | LMIMTVRXKLYERB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |