C31H31ClN6O — CID 135355617
N'-[1-[2-(1-benzylindol-2-yl)-1-methylbenzimidazole-5-carbonyl]piperidin-3-yl]-2-chloroethanimidamide (PubChem CID 135355617) has the molecular formula C31H31ClN6O and a molecular weight of 539.08 g/mol. Its IUPAC name is N'-[1-[2-(1-benzylindol-2-yl)-1-methylbenzimidazole-5-carbonyl]piperidin-3-yl]-2-chloroethanimidamide.
| Compound Name | N'-[1-[2-(1-benzylindol-2-yl)-1-methylbenzimidazole-5-carbonyl]piperidin-3-yl]-2-chloroethanimidamide |
|---|---|
| PubChem CID | 135355617 |
| Molecular Formula | C31H31ClN6O |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | N'-[1-[2-(1-benzylindol-2-yl)-1-methylbenzimidazole-5-carbonyl]piperidin-3-yl]-2-chloroethanimidamide |
| SMILES | Cn1c(-c2cc3ccccc3n2Cc2ccccc2)nc2cc(C(=O)N3CCCC(/N=C(/N)CCl)C3)ccc21 |
| InChI | InChI=1S/C31H31ClN6O/c1-36-27-14-13-23(31(39)37-15-7-11-24(20-37)34-29(33)18-32)16-25(27)35-30(36)28-17-22-10-5-6-12-26(22)38(28)19-21-8-3-2-4-9-21/h2-6,8-10,12-14,16-17,24H,7,11,15,18-20H2,1H3,(H2,33,34) |
| InChIKey | QKGMKJUZKXXCDZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 81.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|