C17H22O5 — CID 122703399
5-[4-[1-(2-carboxyprop-1-enyl)cyclopropyl]-5-oxabicyclo[2.1.0]pentan-1-yl]-2-methylpent-2-enoic acid (PubChem CID 122703399) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 5-[4-[1-(2-carboxyprop-1-enyl)cyclopropyl]-5-oxabicyclo[2.1.0]pentan-1-yl]-2-methylpent-2-enoic acid.
| Compound Name | 5-[4-[1-(2-carboxyprop-1-enyl)cyclopropyl]-5-oxabicyclo[2.1.0]pentan-1-yl]-2-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 122703399 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 5-[4-[1-(2-carboxyprop-1-enyl)cyclopropyl]-5-oxabicyclo[2.1.0]pentan-1-yl]-2-methylpent-2-enoic acid |
| SMILES | CC(=CCCC12CCC1(C1(C=C(C)C(=O)O)CC1)O2)C(=O)O |
| InChI | InChI=1S/C17H22O5/c1-11(13(18)19)4-3-5-16-8-9-17(16,22-16)15(6-7-15)10-12(2)14(20)21/h4,10H,3,5-9H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | UCBPUSJGFMNYHJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|