C18H22O4 — CID 122703981
(2Z)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methyl-2-prop-2-ynylpenta-2,4-dienoic acid (PubChem CID 122703981) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (2Z)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methyl-2-prop-2-ynylpenta-2,4-dienoic acid.
| Compound Name | (2Z)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methyl-2-prop-2-ynylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 122703981 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2Z)-5-[(1S)-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl]-3-methyl-2-prop-2-ynylpenta-2,4-dienoic acid |
| SMILES | C#CC/C(C(=O)O)=C(\C)C=C[C@@]1(O)C(C)=CC(=O)CC1(C)C |
| InChI | InChI=1S/C18H22O4/c1-6-7-15(16(20)21)12(2)8-9-18(22)13(3)10-14(19)11-17(18,4)5/h1,8-10,22H,7,11H2,2-5H3,(H,20,21)/b9-8?,15-12-/t18-/m1/s1 |
| InChIKey | DKHOJCIGNUMKHT-ISZQZSQXSA-N |
| XLogP | 2.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|