C17H22O4 — CID 173480239
2-ethyl-5-(2-hydroxy-1,3-dimethyl-5-oxo-2-bicyclo[4.1.0]hept-3-enyl)-3-methylpenta-2,4-dienoic acid (PubChem CID 173480239) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-ethyl-5-(2-hydroxy-1,3-dimethyl-5-oxo-2-bicyclo[4.1.0]hept-3-enyl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | 2-ethyl-5-(2-hydroxy-1,3-dimethyl-5-oxo-2-bicyclo[4.1.0]hept-3-enyl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 173480239 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-ethyl-5-(2-hydroxy-1,3-dimethyl-5-oxo-2-bicyclo[4.1.0]hept-3-enyl)-3-methylpenta-2,4-dienoic acid |
| SMILES | CCC(C(=O)O)=C(C)C=CC1(O)C(C)=CC(=O)C2CC21C |
| InChI | InChI=1S/C17H22O4/c1-5-12(15(19)20)10(2)6-7-17(21)11(3)8-14(18)13-9-16(13,17)4/h6-8,13,21H,5,9H2,1-4H3,(H,19,20) |
| InChIKey | RIILCUIMKSHBRS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|