C23H36O5 — CID 173480232
2-ethyl-3-[2-(8-hydroxy-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)ethenyl]hex-2-enoic acid (PubChem CID 173480232) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is 2-ethyl-3-[2-(8-hydroxy-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)ethenyl]hex-2-enoic acid.
| Compound Name | 2-ethyl-3-[2-(8-hydroxy-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)ethenyl]hex-2-enoic acid |
|---|---|
| PubChem CID | 173480232 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 2-ethyl-3-[2-(8-hydroxy-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)ethenyl]hex-2-enoic acid |
| SMILES | CCCC(C=CC1(O)C(C)=CC2(CC1(C)C)OC(C)C(C)O2)=C(CC)C(=O)O |
| InChI | InChI=1S/C23H36O5/c1-8-10-18(19(9-2)20(24)25)11-12-23(26)15(3)13-22(14-21(23,6)7)27-16(4)17(5)28-22/h11-13,16-17,26H,8-10,14H2,1-7H3,(H,24,25) |
| InChIKey | FZDKUVOBMQAYOP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|