C21H24F6O5 — CID 123803595
ethyl 5-[8-hydroxy-2,3,7,9-tetramethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-(trifluoromethyl)pent-2-en-4-ynoate (PubChem CID 123803595) has the molecular formula C21H24F6O5 and a molecular weight of 470.41 g/mol. Its IUPAC name is ethyl 5-[8-hydroxy-2,3,7,9-tetramethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-(trifluoromethyl)pent-2-en-4-ynoate.
| Compound Name | ethyl 5-[8-hydroxy-2,3,7,9-tetramethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-(trifluoromethyl)pent-2-en-4-ynoate |
|---|---|
| PubChem CID | 123803595 |
| Molecular Formula | C21H24F6O5 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | ethyl 5-[8-hydroxy-2,3,7,9-tetramethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-(trifluoromethyl)pent-2-en-4-ynoate |
| SMILES | CCOC(=O)C=C(C#CC1(O)C(C)=CC2(CC1(C)C(F)(F)F)OC(C)C(C)O2)C(F)(F)F |
| InChI | InChI=1S/C21H24F6O5/c1-6-30-16(28)9-15(20(22,23)24)7-8-19(29)12(2)10-18(31-13(3)14(4)32-18)11-17(19,5)21(25,26)27/h9-10,13-14,29H,6,11H2,1-5H3 |
| InChIKey | OGHMOSNUIOKCSA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|