C16H22F3NO4 — CID 177455703
ethyl (Z)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)oct-2-en-4-ynoate (PubChem CID 177455703) has the molecular formula C16H22F3NO4 and a molecular weight of 349.35 g/mol. Its IUPAC name is ethyl (Z)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)oct-2-en-4-ynoate.
| Compound Name | ethyl (Z)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)oct-2-en-4-ynoate |
|---|---|
| PubChem CID | 177455703 |
| Molecular Formula | C16H22F3NO4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | ethyl (Z)-8-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(trifluoromethyl)oct-2-en-4-ynoate |
| SMILES | CCOC(=O)/C=C(/C#CCCCNC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H22F3NO4/c1-5-23-13(21)11-12(16(17,18)19)9-7-6-8-10-20-14(22)24-15(2,3)4/h11H,5-6,8,10H2,1-4H3,(H,20,22)/b12-11- |
| InChIKey | WSLGIVROQWRBMN-QXMHVHEDSA-N |
| XLogP | 3.35 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|