C13H25NO6 — CID 175475668
ethyl (2S)-2-hydroxy-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]propanoate (PubChem CID 175475668) has the molecular formula C13H25NO6 and a molecular weight of 291.34 g/mol. Its IUPAC name is ethyl (2S)-2-hydroxy-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]propanoate.
| Compound Name | ethyl (2S)-2-hydroxy-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]propanoate |
|---|---|
| PubChem CID | 175475668 |
| Molecular Formula | C13H25NO6 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | ethyl (2S)-2-hydroxy-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]propanoate |
| SMILES | CCOC(=O)[C@@H](O)COCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO6/c1-5-19-11(16)10(15)9-18-8-6-7-14-12(17)20-13(2,3)4/h10,15H,5-9H2,1-4H3,(H,14,17)/t10-/m0/s1 |
| InChIKey | OLANEMMTQIAKLD-JTQLQIEISA-N |
| XLogP | 0.84 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|