C19H35NO8 — CID 54477505
ethyl 2-(2,3-diethoxy-3-oxopropoxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 54477505) has the molecular formula C19H35NO8 and a molecular weight of 405.49 g/mol. Its IUPAC name is ethyl 2-(2,3-diethoxy-3-oxopropoxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | ethyl 2-(2,3-diethoxy-3-oxopropoxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 54477505 |
| Molecular Formula | C19H35NO8 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | ethyl 2-(2,3-diethoxy-3-oxopropoxy)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CCOC(=O)C(CCCNC(=O)OC(C)(C)C)OCC(OCC)C(=O)OCC |
| InChI | InChI=1S/C19H35NO8/c1-7-24-15(17(22)26-9-3)13-27-14(16(21)25-8-2)11-10-12-20-18(23)28-19(4,5)6/h14-15H,7-13H2,1-6H3,(H,20,23) |
| InChIKey | XMPWELYATXYJQF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|