C12H27NO5Si — CID 123298664
tert-butyl N-[3-[diethoxy(hydroxy)silyl]propyl]carbamate (PubChem CID 123298664) has the molecular formula C12H27NO5Si and a molecular weight of 293.44 g/mol. Its IUPAC name is tert-butyl N-[3-[diethoxy(hydroxy)silyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[diethoxy(hydroxy)silyl]propyl]carbamate |
|---|---|
| PubChem CID | 123298664 |
| Molecular Formula | C12H27NO5Si |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | tert-butyl N-[3-[diethoxy(hydroxy)silyl]propyl]carbamate |
| SMILES | CCO[Si](O)(CCCNC(=O)OC(C)(C)C)OCC |
| InChI | InChI=1S/C12H27NO5Si/c1-6-16-19(15,17-7-2)10-8-9-13-11(14)18-12(3,4)5/h15H,6-10H2,1-5H3,(H,13,14) |
| InChIKey | PNFPPQOZDVRYMQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|