C18H23F3O5 — CID 100938580
methyl (2Z,4E)-5-[(8R,9R)-8-hydroxy-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoate (PubChem CID 100938580) has the molecular formula C18H23F3O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is methyl (2Z,4E)-5-[(8R,9R)-8-hydroxy-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-5-[(8R,9R)-8-hydroxy-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 100938580 |
| Molecular Formula | C18H23F3O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | methyl (2Z,4E)-5-[(8R,9R)-8-hydroxy-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-yl]-3-methylpenta-2,4-dienoate |
| SMILES | COC(=O)/C=C(C)\C=C\[C@@]1(O)C(C)=CC2(C[C@@]1(C)C(F)(F)F)OCCO2 |
| InChI | InChI=1S/C18H23F3O5/c1-12(9-14(22)24-4)5-6-17(23)13(2)10-16(25-7-8-26-16)11-15(17,3)18(19,20)21/h5-6,9-10,23H,7-8,11H2,1-4H3/b6-5+,12-9-/t15-,17-/m1/s1 |
| InChIKey | RHMDFWVMVUIMFY-KHNKNCEBSA-N |
| XLogP | 3.05 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|