C17H23F3O4 — CID 100938584
(8R,9R)-8-[(1E,3Z)-5-hydroxy-3-methylpenta-1,3-dienyl]-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol (PubChem CID 100938584) has the molecular formula C17H23F3O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is (8R,9R)-8-[(1E,3Z)-5-hydroxy-3-methylpenta-1,3-dienyl]-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol.
| Compound Name | (8R,9R)-8-[(1E,3Z)-5-hydroxy-3-methylpenta-1,3-dienyl]-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 100938584 |
| Molecular Formula | C17H23F3O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (8R,9R)-8-[(1E,3Z)-5-hydroxy-3-methylpenta-1,3-dienyl]-7,9-dimethyl-9-(trifluoromethyl)-1,4-dioxaspiro[4.5]dec-6-en-8-ol |
| SMILES | CC1=CC2(C[C@@](C)(C(F)(F)F)[C@@]1(O)/C=C/C(C)=C\CO)OCCO2 |
| InChI | InChI=1S/C17H23F3O4/c1-12(5-7-21)4-6-16(22)13(2)10-15(23-8-9-24-15)11-14(16,3)17(18,19)20/h4-6,10,21-22H,7-9,11H2,1-3H3/b6-4+,12-5-/t14-,16-/m1/s1 |
| InChIKey | CHHPLGYYEDHHJE-LZILQXFHSA-N |
| XLogP | 2.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|