C21H29F3O5 — CID 123152784
ethyl 5-(8-hydroxy-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)-3-(trifluoromethyl)penta-2,4-dienoate (PubChem CID 123152784) has the molecular formula C21H29F3O5 and a molecular weight of 418.45 g/mol. Its IUPAC name is ethyl 5-(8-hydroxy-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)-3-(trifluoromethyl)penta-2,4-dienoate.
| Compound Name | ethyl 5-(8-hydroxy-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)-3-(trifluoromethyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 123152784 |
| Molecular Formula | C21H29F3O5 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | ethyl 5-(8-hydroxy-2,3,7,9,9-pentamethyl-1,4-dioxaspiro[4.5]dec-6-en-8-yl)-3-(trifluoromethyl)penta-2,4-dienoate |
| SMILES | CCOC(=O)C=C(C=CC1(O)C(C)=CC2(CC1(C)C)OC(C)C(C)O2)C(F)(F)F |
| InChI | InChI=1S/C21H29F3O5/c1-7-27-17(25)10-16(21(22,23)24)8-9-20(26)13(2)11-19(12-18(20,5)6)28-14(3)15(4)29-19/h8-11,14-15,26H,7,12H2,1-6H3 |
| InChIKey | KELPKULTFPBIIB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|