C20H23ClN6O — CID 122704337
N-(3-chlorophenyl)-N-hydroxy-2-(2-piperidin-1-ylethyl)-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 122704337) has the molecular formula C20H23ClN6O and a molecular weight of 398.90 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-hydroxy-2-(2-piperidin-1-ylethyl)-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N-(3-chlorophenyl)-N-hydroxy-2-(2-piperidin-1-ylethyl)-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 122704337 |
| Molecular Formula | C20H23ClN6O |
| Molecular Weight | 398.90 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(3-chlorophenyl)-N-hydroxy-2-(2-piperidin-1-ylethyl)-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | [H]/N=C(/c1ccnc2nc(CCN3CCCCC3)[nH]c12)N(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H23ClN6O/c21-14-5-4-6-15(13-14)27(28)19(22)16-7-9-23-20-18(16)24-17(25-20)8-12-26-10-2-1-3-11-26/h4-7,9,13,22,28H,1-3,8,10-12H2,(H,23,24,25)/b22-19- |
| InChIKey | GVNSTWHUIMODCR-QOCHGBHMSA-N |
| XLogP | 3.86 |
| TPSA | 92.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.90 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|