C17H17ClFN7O3 — CID 122704237
3-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]propylcarbamic acid (PubChem CID 122704237) has the molecular formula C17H17ClFN7O3 and a molecular weight of 421.82 g/mol. Its IUPAC name is 3-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]propylcarbamic acid.
| Compound Name | 3-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]propylcarbamic acid |
|---|---|
| PubChem CID | 122704237 |
| Molecular Formula | C17H17ClFN7O3 |
| Molecular Weight | 421.82 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 3-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]propylcarbamic acid |
| SMILES | [H]/N=C(/c1ccnc2nc(NCCCNC(=O)O)[nH]c12)N(O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClFN7O3/c18-11-8-9(2-3-12(11)19)26(29)14(20)10-4-7-21-15-13(10)24-16(25-15)22-5-1-6-23-17(27)28/h2-4,7-8,20,23,29H,1,5-6H2,(H,27,28)(H2,21,22,24,25)/b20-14- |
| InChIKey | UKKLGSCFEGSWBK-ZHZULCJRSA-N |
| XLogP | 3.04 |
| TPSA | 150.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.82 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|