C17H14ClF3N6O2 — CID 122704271
3-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]amino]propanamide (PubChem CID 122704271) has the molecular formula C17H14ClF3N6O2 and a molecular weight of 426.79 g/mol. Its IUPAC name is 3-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]amino]propanamide.
| Compound Name | 3-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]amino]propanamide |
|---|---|
| PubChem CID | 122704271 |
| Molecular Formula | C17H14ClF3N6O2 |
| Molecular Weight | 426.79 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 3-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]amino]propanamide |
| SMILES | [H]/N=C(/c1cc(F)c(F)c2nc(NCCC(N)=O)[nH]c12)N(O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H14ClF3N6O2/c18-9-5-7(1-2-10(9)19)27(29)16(23)8-6-11(20)13(21)15-14(8)25-17(26-15)24-4-3-12(22)28/h1-2,5-6,23,29H,3-4H2,(H2,22,28)(H2,24,25,26)/b23-16- |
| InChIKey | BGEYDFDRHFEVFA-KQWNVCNZSA-N |
| XLogP | 3.14 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.79 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|