C17H16ClF2N5O — CID 122704411
N-(3-chloro-4-fluorophenyl)-2-[(dimethylamino)methyl]-7-fluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide (PubChem CID 122704411) has the molecular formula C17H16ClF2N5O and a molecular weight of 379.80 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[(dimethylamino)methyl]-7-fluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[(dimethylamino)methyl]-7-fluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122704411 |
| Molecular Formula | C17H16ClF2N5O |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[(dimethylamino)methyl]-7-fluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
| SMILES | [H]/N=C(/c1ccc(F)c2nc(CN(C)C)[nH]c12)N(O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H16ClF2N5O/c1-24(2)8-14-22-15-10(4-6-13(20)16(15)23-14)17(21)25(26)9-3-5-12(19)11(18)7-9/h3-7,21,26H,8H2,1-2H3,(H,22,23)/b21-17- |
| InChIKey | RDXGHOIRKMHHBO-FXBPSFAMSA-N |
| XLogP | 3.78 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|