C18H19ClF2N6O — CID 122704516
N-(3-chloro-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]-6-fluoro-N-hydroxy-1H-benzimidazole-4-carboximidamide (PubChem CID 122704516) has the molecular formula C18H19ClF2N6O and a molecular weight of 408.84 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]-6-fluoro-N-hydroxy-1H-benzimidazole-4-carboximidamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]-6-fluoro-N-hydroxy-1H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122704516 |
| Molecular Formula | C18H19ClF2N6O |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[2-(dimethylamino)ethylamino]-6-fluoro-N-hydroxy-1H-benzimidazole-4-carboximidamide |
| SMILES | [H]/N=C(/c1cc(F)cc2[nH]c(NCCN(C)C)nc12)N(O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H19ClF2N6O/c1-26(2)6-5-23-18-24-15-8-10(20)7-12(16(15)25-18)17(22)27(28)11-3-4-14(21)13(19)9-11/h3-4,7-9,22,28H,5-6H2,1-2H3,(H2,23,24,25)/b22-17- |
| InChIKey | ZRFUHJUYDPTZIP-XLNRJJMWSA-N |
| XLogP | 3.69 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|