C22H24ClF3N6O — CID 140863093
N-(3-chloro-4-fluorophenyl)-2-[[(1S,3S)-3-(dimethylamino)cyclohexyl]amino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide (PubChem CID 140863093) has the molecular formula C22H24ClF3N6O and a molecular weight of 480.92 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-[[(1S,3S)-3-(dimethylamino)cyclohexyl]amino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-[[(1S,3S)-3-(dimethylamino)cyclohexyl]amino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 140863093 |
| Molecular Formula | C22H24ClF3N6O |
| Molecular Weight | 480.92 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-[[(1S,3S)-3-(dimethylamino)cyclohexyl]amino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
| SMILES | [H]/N=C(/c1cc(F)c(F)c2nc(N[C@H]3CCC[C@H](N(C)C)C3)[nH]c12)N(O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H24ClF3N6O/c1-31(2)12-5-3-4-11(8-12)28-22-29-19-14(10-17(25)18(26)20(19)30-22)21(27)32(33)13-6-7-16(24)15(23)9-13/h6-7,9-12,27,33H,3-5,8H2,1-2H3,(H2,28,29,30)/b27-21-/t11-,12-/m0/s1 |
| InChIKey | OHEWOCYTDLREGK-KBPRCSNASA-N |
| XLogP | 5.14 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.92 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|