C21H16ClF3N6O — CID 122704506
2-[(2-aminophenyl)methylamino]-N-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide (PubChem CID 122704506) has the molecular formula C21H16ClF3N6O and a molecular weight of 460.85 g/mol. Its IUPAC name is 2-[(2-aminophenyl)methylamino]-N-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide.
| Compound Name | 2-[(2-aminophenyl)methylamino]-N-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122704506 |
| Molecular Formula | C21H16ClF3N6O |
| Molecular Weight | 460.85 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 2-[(2-aminophenyl)methylamino]-N-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
| SMILES | [H]/N=C(/c1cc(F)c(F)c2nc(NCc3ccccc3N)[nH]c12)N(O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C21H16ClF3N6O/c22-13-7-11(5-6-14(13)23)31(32)20(27)12-8-15(24)17(25)19-18(12)29-21(30-19)28-9-10-3-1-2-4-16(10)26/h1-8,27,32H,9,26H2,(H2,28,29,30)/b27-20- |
| InChIKey | QFLOINAAUOLVSA-OOAXWGSJSA-N |
| XLogP | 5.05 |
| TPSA | 114.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|