C17H14ClF3N6O3 — CID 122704456
2-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]amino]ethylcarbamic acid (PubChem CID 122704456) has the molecular formula C17H14ClF3N6O3 and a molecular weight of 442.79 g/mol. Its IUPAC name is 2-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]amino]ethylcarbamic acid.
| Compound Name | 2-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 122704456 |
| Molecular Formula | C17H14ClF3N6O3 |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 2-[[7-[N-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]amino]ethylcarbamic acid |
| SMILES | [H]/N=C(/c1cc(F)c(F)c2nc(NCCNC(=O)O)[nH]c12)N(O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C17H14ClF3N6O3/c18-9-5-7(1-2-10(9)19)27(30)15(22)8-6-11(20)12(21)14-13(8)25-16(26-14)23-3-4-24-17(28)29/h1-2,5-6,22,24,30H,3-4H2,(H,28,29)(H2,23,25,26)/b22-15- |
| InChIKey | KPQPJEZXDJZBLC-JCMHNJIXSA-N |
| XLogP | 3.53 |
| TPSA | 137.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|