C18H17BrF3N5O — CID 122704298
N-(3-bromo-4-fluorophenyl)-2-[2-(dimethylamino)ethyl]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide (PubChem CID 122704298) has the molecular formula C18H17BrF3N5O and a molecular weight of 456.27 g/mol. Its IUPAC name is N-(3-bromo-4-fluorophenyl)-2-[2-(dimethylamino)ethyl]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide.
| Compound Name | N-(3-bromo-4-fluorophenyl)-2-[2-(dimethylamino)ethyl]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122704298 |
| Molecular Formula | C18H17BrF3N5O |
| Molecular Weight | 456.27 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | N-(3-bromo-4-fluorophenyl)-2-[2-(dimethylamino)ethyl]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
| SMILES | [H]/N=C(/c1cc(F)c(F)c2nc(CCN(C)C)[nH]c12)N(O)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C18H17BrF3N5O/c1-26(2)6-5-14-24-16-10(8-13(21)15(22)17(16)25-14)18(23)27(28)9-3-4-12(20)11(19)7-9/h3-4,7-8,23,28H,5-6H2,1-2H3,(H,24,25)/b23-18- |
| InChIKey | LFPPOBSRBSRMJK-NKFKGCMQSA-N |
| XLogP | 4.07 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|