C18H20BrFN6O — CID 122704557
N-(3-bromophenyl)-2-[2-(dimethylamino)ethylamino]-7-fluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide (PubChem CID 122704557) has the molecular formula C18H20BrFN6O and a molecular weight of 435.30 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[2-(dimethylamino)ethylamino]-7-fluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide.
| Compound Name | N-(3-bromophenyl)-2-[2-(dimethylamino)ethylamino]-7-fluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122704557 |
| Molecular Formula | C18H20BrFN6O |
| Molecular Weight | 435.30 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-(3-bromophenyl)-2-[2-(dimethylamino)ethylamino]-7-fluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
| SMILES | [H]/N=C(/c1ccc(F)c2nc(NCCN(C)C)[nH]c12)N(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H20BrFN6O/c1-25(2)9-8-22-18-23-15-13(6-7-14(20)16(15)24-18)17(21)26(27)12-5-3-4-11(19)10-12/h3-7,10,21,27H,8-9H2,1-2H3,(H2,22,23,24)/b21-17- |
| InChIKey | IQHKSAREFQVNJV-FXBPSFAMSA-N |
| XLogP | 3.66 |
| TPSA | 91.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|