C15H17F4NO2 — CID 122704821
2-tert-butyl-3-[fluoro-(2,3,5-trifluorophenyl)methyl]azetidine-1-carboxylic acid (PubChem CID 122704821) has the molecular formula C15H17F4NO2 and a molecular weight of 319.30 g/mol. Its IUPAC name is 2-tert-butyl-3-[fluoro-(2,3,5-trifluorophenyl)methyl]azetidine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-3-[fluoro-(2,3,5-trifluorophenyl)methyl]azetidine-1-carboxylic acid |
|---|---|
| PubChem CID | 122704821 |
| Molecular Formula | C15H17F4NO2 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 2-tert-butyl-3-[fluoro-(2,3,5-trifluorophenyl)methyl]azetidine-1-carboxylic acid |
| SMILES | CC(C)(C)C1C(C(F)c2cc(F)cc(F)c2F)CN1C(=O)O |
| InChI | InChI=1S/C15H17F4NO2/c1-15(2,3)13-9(6-20(13)14(21)22)11(18)8-4-7(16)5-10(17)12(8)19/h4-5,9,11,13H,6H2,1-3H3,(H,21,22) |
| InChIKey | BDDULSUZRQVCPM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|