C17H11BrN2O3S2 — CID 122713381
(5E)-3-[(E)-(4-bromophenyl)methylideneamino]-5-[(2,4-dihydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 122713381) has the molecular formula C17H11BrN2O3S2 and a molecular weight of 435.32 g/mol. Its IUPAC name is (5E)-3-[(E)-(4-bromophenyl)methylideneamino]-5-[(2,4-dihydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[(E)-(4-bromophenyl)methylideneamino]-5-[(2,4-dihydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 122713381 |
| Molecular Formula | C17H11BrN2O3S2 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 433.94 |
| IUPAC Name | (5E)-3-[(E)-(4-bromophenyl)methylideneamino]-5-[(2,4-dihydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(O)cc2O)SC(=S)N1/N=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H11BrN2O3S2/c18-12-4-1-10(2-5-12)9-19-20-16(23)15(25-17(20)24)7-11-3-6-13(21)8-14(11)22/h1-9,21-22H/b15-7+,19-9+ |
| InChIKey | SCBFNLDERPHMDC-QKRIUYJUSA-N |
| XLogP | 4.10 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|