C20H16N2O7S2 — CID 122713170
6-[(E)-[(5E)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]-2,3-dimethoxybenzoic acid (PubChem CID 122713170) has the molecular formula C20H16N2O7S2 and a molecular weight of 460.49 g/mol. Its IUPAC name is 6-[(E)-[(5E)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]-2,3-dimethoxybenzoic acid.
| Compound Name | 6-[(E)-[(5E)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 122713170 |
| Molecular Formula | C20H16N2O7S2 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 6-[(E)-[(5E)-5-[(2,4-dihydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]iminomethyl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1ccc(/C=N/N2C(=O)/C(=C\c3ccc(O)cc3O)SC2=S)c(C(=O)O)c1OC |
| InChI | InChI=1S/C20H16N2O7S2/c1-28-14-6-4-11(16(19(26)27)17(14)29-2)9-21-22-18(25)15(31-20(22)30)7-10-3-5-12(23)8-13(10)24/h3-9,23-24H,1-2H3,(H,26,27)/b15-7+,21-9+ |
| InChIKey | GREYFFBMQNBZCP-DGHKFVSSSA-N |
| XLogP | 3.05 |
| TPSA | 128.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|