C21H19NO7S2 — CID 27410892
6-[(E)-[3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid (PubChem CID 27410892) has the molecular formula C21H19NO7S2 and a molecular weight of 461.52 g/mol. Its IUPAC name is 6-[(E)-[3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid.
| Compound Name | 6-[(E)-[3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 27410892 |
| Molecular Formula | C21H19NO7S2 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 6-[(E)-[3-(2,4-dimethoxyphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3-dimethoxybenzoic acid |
| SMILES | COc1ccc(N2C(=O)/C(=C\c3ccc(OC)c(OC)c3C(=O)O)SC2=S)c(OC)c1 |
| InChI | InChI=1S/C21H19NO7S2/c1-26-12-6-7-13(15(10-12)28-3)22-19(23)16(31-21(22)30)9-11-5-8-14(27-2)18(29-4)17(11)20(24)25/h5-10H,1-4H3,(H,24,25)/b16-9+ |
| InChIKey | CDUKPFNOFMCFLE-CXUHLZMHSA-N |
| XLogP | 3.83 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|