C20H15N3O3S2 — CID 50739925
(5Z)-3-(2,4-dimethoxyphenyl)-5-(quinoxalin-6-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 50739925) has the molecular formula C20H15N3O3S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is (5Z)-3-(2,4-dimethoxyphenyl)-5-(quinoxalin-6-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2,4-dimethoxyphenyl)-5-(quinoxalin-6-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 50739925 |
| Molecular Formula | C20H15N3O3S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | (5Z)-3-(2,4-dimethoxyphenyl)-5-(quinoxalin-6-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(N2C(=O)/C(=C/c3ccc4nccnc4c3)SC2=S)c(OC)c1 |
| InChI | InChI=1S/C20H15N3O3S2/c1-25-13-4-6-16(17(11-13)26-2)23-19(24)18(28-20(23)27)10-12-3-5-14-15(9-12)22-8-7-21-14/h3-11H,1-2H3/b18-10- |
| InChIKey | SPHSVUREHZNMSR-ZDLGFXPLSA-N |
| XLogP | 4.05 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|