C16H9N3O6S2 — CID 122713736
(5Z)-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 122713736) has the molecular formula C16H9N3O6S2 and a molecular weight of 403.40 g/mol. Its IUPAC name is (5Z)-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 122713736 |
| Molecular Formula | C16H9N3O6S2 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | (5Z)-5-[(E)-3-(5-nitrofuran-2-yl)prop-2-enylidene]-3-(4-nitrophenyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/C=C/c2ccc([N+](=O)[O-])o2)SC(=S)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H9N3O6S2/c20-15-13(3-1-2-12-8-9-14(25-12)19(23)24)27-16(26)17(15)10-4-6-11(7-5-10)18(21)22/h1-9H/b2-1+,13-3- |
| InChIKey | OWUJOCUMJMLKJF-LIPWGUAESA-N |
| XLogP | 4.06 |
| TPSA | 119.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|