C15H7Cl3N2OS2 — CID 122714024
(5Z)-3-(5-chloro-2-pyridinyl)-5-[(2,6-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 122714024) has the molecular formula C15H7Cl3N2OS2 and a molecular weight of 401.73 g/mol. Its IUPAC name is (5Z)-3-(5-chloro-2-pyridinyl)-5-[(2,6-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(5-chloro-2-pyridinyl)-5-[(2,6-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 122714024 |
| Molecular Formula | C15H7Cl3N2OS2 |
| Molecular Weight | 401.73 g/mol |
| Exact Mass | 399.91 |
| IUPAC Name | (5Z)-3-(5-chloro-2-pyridinyl)-5-[(2,6-dichlorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2c(Cl)cccc2Cl)SC(=S)N1c1ccc(Cl)cn1 |
| InChI | InChI=1S/C15H7Cl3N2OS2/c16-8-4-5-13(19-7-8)20-14(21)12(23-15(20)22)6-9-10(17)2-1-3-11(9)18/h1-7H/b12-6- |
| InChIKey | DYPUNDVSOLQIEI-SDQBBNPISA-N |
| XLogP | 5.45 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.73 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|