C18H13Cl2N3O2S2 — CID 53257036
2-[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(pyridin-4-ylmethyl)acetamide (PubChem CID 53257036) has the molecular formula C18H13Cl2N3O2S2 and a molecular weight of 438.36 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(pyridin-4-ylmethyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(pyridin-4-ylmethyl)acetamide |
|---|---|
| PubChem CID | 53257036 |
| Molecular Formula | C18H13Cl2N3O2S2 |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | 2-[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(pyridin-4-ylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2c(Cl)cccc2Cl)SC1=S)NCc1ccncc1 |
| InChI | InChI=1S/C18H13Cl2N3O2S2/c19-13-2-1-3-14(20)12(13)8-15-17(25)23(18(26)27-15)10-16(24)22-9-11-4-6-21-7-5-11/h1-8H,9-10H2,(H,22,24)/b15-8- |
| InChIKey | WVXXCPNOEQQFHN-NVNXTCNLSA-N |
| XLogP | 3.91 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|