C16H16Cl2N4O2S2 — CID 53346528
2-[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-piperazin-1-ylacetamide (PubChem CID 53346528) has the molecular formula C16H16Cl2N4O2S2 and a molecular weight of 431.37 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-piperazin-1-ylacetamide.
| Compound Name | 2-[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 53346528 |
| Molecular Formula | C16H16Cl2N4O2S2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 2-[(5Z)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-piperazin-1-ylacetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2c(Cl)cccc2Cl)SC1=S)NN1CCNCC1 |
| InChI | InChI=1S/C16H16Cl2N4O2S2/c17-11-2-1-3-12(18)10(11)8-13-15(24)22(16(25)26-13)9-14(23)20-21-6-4-19-5-7-21/h1-3,8,19H,4-7,9H2,(H,20,23)/b13-8- |
| InChIKey | OIMJRMXTWBMIIO-JYRVWZFOSA-N |
| XLogP | 2.13 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|