C19H14Cl2N2O3S2 — CID 4161491
methyl 4-[[5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylamino]benzoate (PubChem CID 4161491) has the molecular formula C19H14Cl2N2O3S2 and a molecular weight of 453.37 g/mol. Its IUPAC name is methyl 4-[[5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylamino]benzoate.
| Compound Name | methyl 4-[[5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylamino]benzoate |
|---|---|
| PubChem CID | 4161491 |
| Molecular Formula | C19H14Cl2N2O3S2 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 451.98 |
| IUPAC Name | methyl 4-[[5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methylamino]benzoate |
| SMILES | COC(=O)c1ccc(NCN2C(=O)C(=Cc3c(Cl)cccc3Cl)SC2=S)cc1 |
| InChI | InChI=1S/C19H14Cl2N2O3S2/c1-26-18(25)11-5-7-12(8-6-11)22-10-23-17(24)16(28-19(23)27)9-13-14(20)3-2-4-15(13)21/h2-9,22H,10H2,1H3 |
| InChIKey | XZXVYNLLHWEZQN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|