C8H19NSi — CID 122714220
2-(1,1-dimethylsilolan-3-yl)ethanamine (PubChem CID 122714220) has the molecular formula C8H19NSi and a molecular weight of 157.33 g/mol. Its IUPAC name is 2-(1,1-dimethylsilolan-3-yl)ethanamine.
| Compound Name | 2-(1,1-dimethylsilolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 122714220 |
| Molecular Formula | C8H19NSi |
| Molecular Weight | 157.33 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 2-(1,1-dimethylsilolan-3-yl)ethanamine |
| SMILES | C[Si]1(C)CCC(CCN)C1 |
| InChI | InChI=1S/C8H19NSi/c1-10(2)6-4-8(7-10)3-5-9/h8H,3-7,9H2,1-2H3 |
| InChIKey | RJTIZTRROHXZDA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|