C19H23ClN2O5 — CID 122714602
[2-methyl-2-(pyridine-4-carbonylamino)propyl] 2-(4-methoxyphenoxy)acetate;hydrochloride (PubChem CID 122714602) has the molecular formula C19H23ClN2O5 and a molecular weight of 394.86 g/mol. Its IUPAC name is [2-methyl-2-(pyridine-4-carbonylamino)propyl] 2-(4-methoxyphenoxy)acetate;hydrochloride.
| Compound Name | [2-methyl-2-(pyridine-4-carbonylamino)propyl] 2-(4-methoxyphenoxy)acetate;hydrochloride |
|---|---|
| PubChem CID | 122714602 |
| Molecular Formula | C19H23ClN2O5 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | [2-methyl-2-(pyridine-4-carbonylamino)propyl] 2-(4-methoxyphenoxy)acetate;hydrochloride |
| SMILES | COc1ccc(OCC(=O)OCC(C)(C)NC(=O)c2ccncc2)cc1.Cl |
| InChI | InChI=1S/C19H22N2O5.ClH/c1-19(2,21-18(23)14-8-10-20-11-9-14)13-26-17(22)12-25-16-6-4-15(24-3)5-7-16;/h4-11H,12-13H2,1-3H3,(H,21,23);1H |
| InChIKey | VBESTXHWOVRSRR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |