C12H11ClF3N3O — CID 122715031
3-amino-6-methyl-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one;hydrochloride (PubChem CID 122715031) has the molecular formula C12H11ClF3N3O and a molecular weight of 305.69 g/mol. Its IUPAC name is 3-amino-6-methyl-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one;hydrochloride.
| Compound Name | 3-amino-6-methyl-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one;hydrochloride |
|---|---|
| PubChem CID | 122715031 |
| Molecular Formula | C12H11ClF3N3O |
| Molecular Weight | 305.69 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 3-amino-6-methyl-1-[3-(trifluoromethyl)phenyl]pyridazin-4-one;hydrochloride |
| SMILES | Cc1cc(=O)c(N)nn1-c1cccc(C(F)(F)F)c1.Cl |
| InChI | InChI=1S/C12H10F3N3O.ClH/c1-7-5-10(19)11(16)17-18(7)9-4-2-3-8(6-9)12(13,14)15;/h2-6H,1H3,(H2,16,17);1H |
| InChIKey | JAVOSLLQTTWILQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.69 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |