C11H10N2O2S2 — CID 1227506
N-[(5Z)-5-[(3-methylthiophen-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide (PubChem CID 1227506) has the molecular formula C11H10N2O2S2 and a molecular weight of 266.35 g/mol. Its IUPAC name is N-[(5Z)-5-[(3-methylthiophen-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[(5Z)-5-[(3-methylthiophen-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 1227506 |
| Molecular Formula | C11H10N2O2S2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | N-[(5Z)-5-[(3-methylthiophen-2-yl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)NC1=NC(=O)/C(=C/c2sccc2C)S1 |
| InChI | InChI=1S/C11H10N2O2S2/c1-6-3-4-16-8(6)5-9-10(15)13-11(17-9)12-7(2)14/h3-5H,1-2H3,(H,12,13,14,15)/b9-5- |
| InChIKey | JPFVCPXVIMKIBN-UITAMQMPSA-N |
| XLogP | 2.16 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|