C11H12N2OS2 — CID 1254723
(5Z)-3-methyl-2-methylimino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 1254723) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (5Z)-3-methyl-2-methylimino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-methyl-2-methylimino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1254723 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (5Z)-3-methyl-2-methylimino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | C/N=C1\S/C(=C\c2sccc2C)C(=O)N1C |
| InChI | InChI=1S/C11H12N2OS2/c1-7-4-5-15-8(7)6-9-10(14)13(3)11(12-2)16-9/h4-6H,1-3H3/b9-6-,12-11- |
| InChIKey | ORYPKVJBBRPASI-KTXOSSPPSA-N |
| XLogP | 2.59 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|