C15H26O3 — CID 12304812
Kessyl glycol (PubChem CID 12304812) has the molecular formula C15H26O3 and a molecular weight of 254.36 g/mol. Its IUPAC name is (1S,2S,3R,5R,6R,8S,12S)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-3,12-diol.
| Compound Name | Kessyl glycol |
|---|---|
| PubChem CID | 12304812 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (1S,2S,3R,5R,6R,8S,12S)-1,5,9,9-tetramethyl-10-oxatricyclo[6.2.2.02,6]dodecane-3,12-diol |
| SMILES | C[C@@H]1C[C@H]([C@@H]2[C@@H]1C[C@H]3[C@H](C[C@@]2(OC3(C)C)C)O)O |
| InChI | InChI=1S/C15H26O3/c1-8-5-11(16)13-9(8)6-10-12(17)7-15(13,4)18-14(10,2)3/h8-13,16-17H,5-7H2,1-4H3/t8-,9-,10+,11-,12+,13+,15+/m1/s1 |
| InChIKey | HMTVXYYWICMXMY-YSVDCJIHSA-N |
| XLogP | 1.70 |
| TPSA | 49.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | 354 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |