C22H32O5S — CID 123104268
2-[2-(4-tert-butylcyclohexyl)oxy-2-oxoethyl]sulfinyl-4-phenylbutanoic acid (PubChem CID 123104268) has the molecular formula C22H32O5S and a molecular weight of 408.56 g/mol. Its IUPAC name is 2-[2-(4-tert-butylcyclohexyl)oxy-2-oxoethyl]sulfinyl-4-phenylbutanoic acid.
| Compound Name | 2-[2-(4-tert-butylcyclohexyl)oxy-2-oxoethyl]sulfinyl-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 123104268 |
| Molecular Formula | C22H32O5S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[2-(4-tert-butylcyclohexyl)oxy-2-oxoethyl]sulfinyl-4-phenylbutanoic acid |
| SMILES | CC(C)(C)C1CCC(OC(=O)CS(=O)C(CCc2ccccc2)C(=O)O)CC1 |
| InChI | InChI=1S/C22H32O5S/c1-22(2,3)17-10-12-18(13-11-17)27-20(23)15-28(26)19(21(24)25)14-9-16-7-5-4-6-8-16/h4-8,17-19H,9-15H2,1-3H3,(H,24,25) |
| InChIKey | YEMQNRYKRNKADU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |