C19H19NO6S — CID 123106818
4-[[2-(2-ethoxycarbonylanilino)-2-oxoethyl]sulfinylmethyl]benzoic acid (PubChem CID 123106818) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is 4-[[2-(2-ethoxycarbonylanilino)-2-oxoethyl]sulfinylmethyl]benzoic acid.
| Compound Name | 4-[[2-(2-ethoxycarbonylanilino)-2-oxoethyl]sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 123106818 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 4-[[2-(2-ethoxycarbonylanilino)-2-oxoethyl]sulfinylmethyl]benzoic acid |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CS(=O)Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H19NO6S/c1-2-26-19(24)15-5-3-4-6-16(15)20-17(21)12-27(25)11-13-7-9-14(10-8-13)18(22)23/h3-10H,2,11-12H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | DDWHPRFOSAAWRK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |