About cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate
cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate (PubChem CID 123117592) has the molecular formula C13H24O5S
and a molecular weight of 292.40 g/mol. Its IUPAC name is cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate.
Molecular Properties
| Compound Name | cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate |
| PubChem CID | 123117592 |
| Molecular Formula | C13H24O5S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate |
| SMILES | CCC(C(=O)OC1CCCCC1)S(=O)CC(O)CO |
| InChI | InChI=1S/C13H24O5S/c1-2-12(19(17)9-10(15)8-14)13(16)18-11-6-4-3-5-7-11/h10-12,14-15H,2-9H2,1H3 |
| InChIKey | YKJKZMZJQHGAJI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate?
The IUPAC name of cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate (CID 123117592) is cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate.
What is the SMILES notation for cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate?
The canonical SMILES for cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate is CCC(C(=O)OC1CCCCC1)S(=O)CC(O)CO.
What is the InChIKey of cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate?
The InChIKey is YKJKZMZJQHGAJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O5S/c1-2-12(19(17)9-10(15)8-14)13(16)18-11-6-4-3-5-7-11/h10-12,14-15H,2-9H2,1H3.
What are the key properties of cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate?
cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate has a molecular weight of 292.40 g/mol, XLogP of 0.74, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2-(2,3-dihydroxypropylsulfinyl)butanoate is sourced from PubChem (CID 123117592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).