C14H21NO5S — CID 123123593
methyl 4-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]butanoate (PubChem CID 123123593) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is methyl 4-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]butanoate.
| Compound Name | methyl 4-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]butanoate |
|---|---|
| PubChem CID | 123123593 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | methyl 4-[(4-oxo-5-propoxy-1H-pyridin-2-yl)methylsulfinyl]butanoate |
| SMILES | CCCOc1c[nH]c(CS(=O)CCCC(=O)OC)cc1=O |
| InChI | InChI=1S/C14H21NO5S/c1-3-6-20-13-9-15-11(8-12(13)16)10-21(18)7-4-5-14(17)19-2/h8-9H,3-7,10H2,1-2H3,(H,15,16) |
| InChIKey | IHLFNRGMVOQIMU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |